kaylam476 kaylam476

12-10-2022
Mathematics

contestada

Classify the following numbers as rational
or irrational.
3.1415926535... 0 V1 7.4 15 V3

pls helpp

Respuesta :

Otras preguntas

Write down the rule in your own words to describe this pattern:3-6;12;-24;48

Find the equation of the line with slope m=−1/2 that contains the point (2,−4).

Something China and Japan have in common

You have $150 to spend at a store. If you shoes cost $30 and belts cost $25, write an equation that represents the different ways that you could spend a total o

Work out the value of (2³)²

Please can someone help me with this question.

The act of depending on one another for fulfilment of one’s needs

"A small piece, well made and well kept, will give more satisfaction than a larger plot of inferior turf." Identify the sentence structure. Anaphora Triadic sen

What role did rivers play in the rise of the shang dynasty and the other three ancient civilization

What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2