tendousnaniwos tendousnaniwos

10-12-2020
Biology

contestada

Why can't proteins and starch enter the cell?

Respuesta :

Аноним Аноним

11-12-2020

Answer:

This is because the cell membrane is a partially permeable membrane, hence allowing the smaller molecules to enter it and larger molecules to be out. For example, protein is too large to enter the cell

Explanation:

Answer Link

Otras preguntas

Which word best describes Eleanor Roosevelt as a young child? A. brave B. friendly C. lonely D. proud

Tobin performed an experiment in which he mixed varying amounts of enzyme with an excess amount of substrate. He measured the rate of each reaction and recorded

simplify the expression using sum or difference identities cos(12)cos(-3)-sin(12)sin(-3)

Find the value of x if this is a rectangle.

This__ reinforces the highest standard of individual and collective behavior

Help me please to number 3?

Why is it important for more young people to get involved in agriculture? Why should they be excited to join the industry?

rewrite the function by completing the square [tex]f(x) = {x}^{2} - 2x + 17[/tex][tex]f(x) = (x + |?| )^{2} + |?| [/tex]

________ is the second step in the target marketing process. in this step, marketers evaluate segments and decide which segment to go after.

Which of these would be the best definition of energy? A) the ability to do work B) the development of a future source of fuel C) the feeling one gets from dr