haileyshockley haileyshockley

11-03-2021
Mathematics

contestada

Please identify if these events are independent or dependent events.

Please identify if these events are independent or dependent events class=

Respuesta :

timmyabc19 timmyabc19

11-03-2021

Answer:

8 is independent because the names get returned,

9 is dependent because they are two events that depend on eachother

10 is dependent because you have to wait until the other person makes their move.

Hope this helps and brainliest please

Answer Link

Otras preguntas

What is the probability that it weights less than 26 kilograms?

What are some links between Judaism, christianity and islam?

why did western europe begin a fifteenth century expansion of oceanic transregional trade and exploration?

A study was conducted of pleas made by 1 comma 0.32 criminals. Among those criminals, 953 plead guilty, and 393 of them were sentenced to prison. Among the 79

can you calculate unit rate given larger quantities (ex. 6 apples for $3.60)

Increasing technological innovation has helped to create an era of risk and instability. Globalization, new technologies, and greater transparency have combined

Which of the following statements is NOT true regarding location decisions? A. Location decisions are important because location has a major impact on the ove

In Triangle XYZ, A is the midpoint of XY, B is the midpoint of YZ, and C is the midpoint of XZ.Also, AY = 7. BZ = 8, and XZ = 18. What is the perimeter of Trian

The circle C has equation[tex](x - 6)^{2} + (y - 5)^{2} = 17[/tex]The lines L1 and L2 are each a tangent to the circle and intersect at the point (0, 12). Fin

Give the structural formula of the compound with the condensed structural formula of CH3C(CH3)2C(CH2CH3)2CH2CH2CH2CH2CH3. Draw the molecule on the canvas by cho