Smokeclown Smokeclown

12-05-2017
Chemistry

contestada

balance this equation
Pb(NO3)2+Na2(CrO4)=Pb(CtO4)+Na(NO3)

Respuesta :

haneylia haneylia

12-05-2017

I'm guessing you mean Cr (Chromium) in the product instead of Ct.

Pb(NO3)2 + Na2(CrO4) = Pb(CtO4) + 2Na(NO3)

Answer Link

Otras preguntas

in Ms Perron's class there are 24 students. 18 of them are boys. what percents of the students are girls?

what is special about nitrogen ,and what is its main function in the atmosphere

Which of the following jobs is in the agriculture career cluster ? A. Warehouse manager B. Audio/video technician C. Animal scientist D. Accountant

in the months leading up to world war 1, the united States wanted to maintain its neutrality because? A,president Wilson was a Quaker and was against warfare of

Factor c^3+64?? Help me

Thermal power plants heat __ to create steam A wood B water C plants D fossil fuel

Which reaction of the grieving process involves feeling ill? A. hurt B. acceptance C. guilt D. physical symptoms

What is the relationship between genius and drill?

A map scale shows 1 inch=30 miles. How many miles do 5.25 inches represent

How did the dust bowl caused okies to prefer life in california over life on the great plains?